C22H31N5O6S — CID 18313373
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18313373) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18313373 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]acetyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CSCCC(N)C(=O)NCC(=O)NC(C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O)C(C)O |
| InChI | InChI=1S/C22H31N5O6S/c1-12(28)19(27-18(29)11-25-20(30)15(23)7-8-34-2)21(31)26-17(22(32)33)9-13-10-24-16-6-4-3-5-14(13)16/h3-6,10,12,15,17,19,24,28H,7-9,11,23H2,1-2H3,(H,25,30)(H,26,31)(H,27,29)(H,32,33) |
| InChIKey | JRTBYGDTDGXDTQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |