C22H29N5O8 — CID 19945166
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 19945166) has the molecular formula C22H29N5O8 and a molecular weight of 491.50 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19945166 |
| Molecular Formula | C22H29N5O8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(NC(=O)CNC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H29N5O8/c1-11(28)19(21(33)26-16(22(34)35)6-7-18(30)31)27-17(29)10-25-20(32)14(23)8-12-9-24-15-5-3-2-4-13(12)15/h2-5,9,11,14,16,19,24,28H,6-8,10,23H2,1H3,(H,25,32)(H,26,33)(H,27,29)(H,30,31)(H,34,35) |
| InChIKey | LZRXOTQQLGOUNT-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |