C21H29N5O7 — CID 19948577
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 19948577) has the molecular formula C21H29N5O7 and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19948577 |
| Molecular Formula | C21H29N5O7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)CNC(=O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)O)C(=O)O |
| InChI | InChI=1S/C21H29N5O7/c1-10(27)17(20(31)24-9-16(29)25-18(11(2)28)21(32)33)26-19(30)14(22)7-12-8-23-15-6-4-3-5-13(12)15/h3-6,8,10-11,14,17-18,23,27-28H,7,9,22H2,1-2H3,(H,24,31)(H,25,29)(H,26,30)(H,32,33) |
| InChIKey | GMPSBAQLFDJQLB-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 206.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |