C23H33N5O6 — CID 19948608
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]acetic acid (PubChem CID 19948608) has the molecular formula C23H33N5O6 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 19948608 |
| Molecular Formula | C23H33N5O6 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoyl]amino]acetic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(C)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H33N5O6/c1-4-12(2)19(22(33)26-11-18(30)31)27-23(34)20(13(3)29)28-21(32)16(24)9-14-10-25-17-8-6-5-7-15(14)17/h5-8,10,12-13,16,19-20,25,29H,4,9,11,24H2,1-3H3,(H,26,33)(H,27,34)(H,28,32)(H,30,31) |
| InChIKey | PCKBSVIYFIQIOT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |