C21H28N6O7 — CID 19948563
4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 19948563) has the molecular formula C21H28N6O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19948563 |
| Molecular Formula | C21H28N6O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 4-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H28N6O7/c1-10(28)18(20(32)25-9-17(30)26-15(21(33)34)7-16(23)29)27-19(31)13(22)6-11-8-24-14-5-3-2-4-12(11)14/h2-5,8,10,13,15,18,24,28H,6-7,9,22H2,1H3,(H2,23,29)(H,25,32)(H,26,30)(H,27,31)(H,33,34) |
| InChIKey | SEOSOIASOSALGZ-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |