C18H30F3N5 — CID 18315309
4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]butan-1-amine (PubChem CID 18315309) has the molecular formula C18H30F3N5 and a molecular weight of 373.47 g/mol. Its IUPAC name is 4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]butan-1-amine.
| Compound Name | 4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 18315309 |
| Molecular Formula | C18H30F3N5 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]butan-1-amine |
| SMILES | CC(C)(C)c1nc(N2CCCN(CCCCN)CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H30F3N5/c1-17(2,3)16-23-14(18(19,20)21)13-15(24-16)26-10-6-9-25(11-12-26)8-5-4-7-22/h13H,4-12,22H2,1-3H3 |
| InChIKey | IZGTUBLPKONZMK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|