C13H14Cl2N2S — CID 18316095
3-(cyclopropylmethyl)-N-(2,4-dichlorophenyl)-1,3-thiazolidin-2-imine (PubChem CID 18316095) has the molecular formula C13H14Cl2N2S and a molecular weight of 301.24 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-N-(2,4-dichlorophenyl)-1,3-thiazolidin-2-imine.
| Compound Name | 3-(cyclopropylmethyl)-N-(2,4-dichlorophenyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 18316095 |
| Molecular Formula | C13H14Cl2N2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-(cyclopropylmethyl)-N-(2,4-dichlorophenyl)-1,3-thiazolidin-2-imine |
| SMILES | Clc1ccc(/N=C2/SCCN2CC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2S/c14-10-3-4-12(11(15)7-10)16-13-17(5-6-18-13)8-9-1-2-9/h3-4,7,9H,1-2,5-6,8H2/b16-13+ |
| InChIKey | WETLHAOZQLKMTE-DTQAZKPQSA-N |
| XLogP | 4.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|