C8H5F3N2O4 — CID 18318131
2,2,2-trifluoro-N-(4-hydroxy-3-nitrophenyl)acetamide (PubChem CID 18318131) has the molecular formula C8H5F3N2O4 and a molecular weight of 250.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-hydroxy-3-nitrophenyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(4-hydroxy-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 18318131 |
| Molecular Formula | C8H5F3N2O4 |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-hydroxy-3-nitrophenyl)acetamide |
| SMILES | O=C(Nc1ccc(O)c([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C8H5F3N2O4/c9-8(10,11)7(15)12-4-1-2-6(14)5(3-4)13(16)17/h1-3,14H,(H,12,15) |
| InChIKey | UMGPWYSDVXAAFV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|