C13H16ClNO2S — CID 18320639
2-[2-(chloromethyl)prop-2-enyl]-3,3-dimethyl-1,2-benzothiazole 1,1-dioxide (PubChem CID 18320639) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is 2-[2-(chloromethyl)prop-2-enyl]-3,3-dimethyl-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 2-[2-(chloromethyl)prop-2-enyl]-3,3-dimethyl-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 18320639 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[2-(chloromethyl)prop-2-enyl]-3,3-dimethyl-1,2-benzothiazole 1,1-dioxide |
| SMILES | C=C(CCl)CN1C(C)(C)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H16ClNO2S/c1-10(8-14)9-15-13(2,3)11-6-4-5-7-12(11)18(15,16)17/h4-7H,1,8-9H2,2-3H3 |
| InChIKey | YSCHNWFSEHUYIF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|