C14H12ClNO2S — CID 510580
3-(3-chlorophenyl)-2-methyl-3H-1,2-benzothiazole 1,1-dioxide (PubChem CID 510580) has the molecular formula C14H12ClNO2S and a molecular weight of 293.78 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-methyl-3H-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-(3-chlorophenyl)-2-methyl-3H-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 510580 |
| Molecular Formula | C14H12ClNO2S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-(3-chlorophenyl)-2-methyl-3H-1,2-benzothiazole 1,1-dioxide |
| SMILES | CN1C(c2cccc(Cl)c2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H12ClNO2S/c1-16-14(10-5-4-6-11(15)9-10)12-7-2-3-8-13(12)19(16,17)18/h2-9,14H,1H3 |
| InChIKey | FRKXFEWITZZSSD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |