C14H27NO6S — CID 18323596
4-amino-1-(2-methylnonan-3-yloxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 18323596) has the molecular formula C14H27NO6S and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-amino-1-(2-methylnonan-3-yloxy)-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 4-amino-1-(2-methylnonan-3-yloxy)-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 18323596 |
| Molecular Formula | C14H27NO6S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-amino-1-(2-methylnonan-3-yloxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCCCC(OC(=O)C(CC(N)=O)S(=O)(=O)O)C(C)C |
| InChI | InChI=1S/C14H27NO6S/c1-4-5-6-7-8-11(10(2)3)21-14(17)12(9-13(15)16)22(18,19)20/h10-12H,4-9H2,1-3H3,(H2,15,16)(H,18,19,20) |
| InChIKey | FVSGTFATIZAWRN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|