About 2-formylbutanedinitrile
2-formylbutanedinitrile (PubChem CID 18323753) has the molecular formula C5H4N2O
and a molecular weight of 108.10 g/mol. Its IUPAC name is 2-formylbutanedinitrile.
Molecular Properties
| Compound Name | 2-formylbutanedinitrile |
| PubChem CID | 18323753 |
| Molecular Formula | C5H4N2O |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.03 |
| IUPAC Name | 2-formylbutanedinitrile |
| SMILES | N#CCC(C#N)C=O |
| InChI | InChI=1S/C5H4N2O/c6-2-1-5(3-7)4-8/h4-5H,1H2 |
| InChIKey | MPBITFKSUGIJHH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formylbutanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formylbutanedinitrile?
The IUPAC name of 2-formylbutanedinitrile (CID 18323753) is 2-formylbutanedinitrile.
What is the SMILES notation for 2-formylbutanedinitrile?
The canonical SMILES for 2-formylbutanedinitrile is N#CCC(C#N)C=O.
What is the InChIKey of 2-formylbutanedinitrile?
The InChIKey is MPBITFKSUGIJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O/c6-2-1-5(3-7)4-8/h4-5H,1H2.
What are the key properties of 2-formylbutanedinitrile?
2-formylbutanedinitrile has a molecular weight of 108.10 g/mol, XLogP of 0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylbutanedinitrile is sourced from PubChem (CID 18323753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).