C6H14O4S4 — CID 18324567
hydroxy-(1-hydroxysulfonothioylhexan-3-yl)-oxo-sulfanylidene-λ6-sulfane (PubChem CID 18324567) has the molecular formula C6H14O4S4 and a molecular weight of 278.44 g/mol. Its IUPAC name is hydroxy-(1-hydroxysulfonothioylhexan-3-yl)-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | hydroxy-(1-hydroxysulfonothioylhexan-3-yl)-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 18324567 |
| Molecular Formula | C6H14O4S4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | hydroxy-(1-hydroxysulfonothioylhexan-3-yl)-oxo-sulfanylidene-λ6-sulfane |
| SMILES | CCCC(CCS(=O)(O)=S)S(=O)(O)=S |
| InChI | InChI=1S/C6H14O4S4/c1-2-3-6(14(9,10)12)4-5-13(7,8)11/h6H,2-5H2,1H3,(H,7,8,11)(H,9,10,12) |
| InChIKey | UKACDCRLEUMJIN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |