C4H10O4S4 — CID 18324572
hydroxy-(1-hydroxysulfonothioylbutyl)-oxo-sulfanylidene-λ6-sulfane (PubChem CID 18324572) has the molecular formula C4H10O4S4 and a molecular weight of 250.39 g/mol. Its IUPAC name is hydroxy-(1-hydroxysulfonothioylbutyl)-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | hydroxy-(1-hydroxysulfonothioylbutyl)-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 18324572 |
| Molecular Formula | C4H10O4S4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 249.95 |
| IUPAC Name | hydroxy-(1-hydroxysulfonothioylbutyl)-oxo-sulfanylidene-λ6-sulfane |
| SMILES | CCCC(S(=O)(O)=S)S(=O)(O)=S |
| InChI | InChI=1S/C4H10O4S4/c1-2-3-4(11(5,6)9)12(7,8)10/h4H,2-3H2,1H3,(H,5,6,9)(H,7,8,10) |
| InChIKey | DIHGLXKVDJXVEN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |