About butan-2-ol;sulfurothioic O-acid
butan-2-ol;sulfurothioic O-acid (PubChem CID 175241517) has the molecular formula C4H12O4S2
and a molecular weight of 188.27 g/mol. Its IUPAC name is butan-2-ol;sulfurothioic O-acid.
Molecular Properties
| Compound Name | butan-2-ol;sulfurothioic O-acid |
| PubChem CID | 175241517 |
| Molecular Formula | C4H12O4S2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | butan-2-ol;sulfurothioic O-acid |
| SMILES | CCC(C)O.O=S(O)(O)=S |
| InChI | InChI=1S/C4H10O.H2O3S2/c1-3-4(2)5;1-5(2,3)4/h4-5H,3H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | HSQWUWKUZQLUHJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-2-ol;sulfurothioic O-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;sulfurothioic O-acid?
The IUPAC name of butan-2-ol;sulfurothioic O-acid (CID 175241517) is butan-2-ol;sulfurothioic O-acid.
What is the SMILES notation for butan-2-ol;sulfurothioic O-acid?
The canonical SMILES for butan-2-ol;sulfurothioic O-acid is CCC(C)O.O=S(O)(O)=S.
What is the InChIKey of butan-2-ol;sulfurothioic O-acid?
The InChIKey is HSQWUWKUZQLUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.H2O3S2/c1-3-4(2)5;1-5(2,3)4/h4-5H,3H2,1-2H3;(H2,1,2,3,4).
What are the key properties of butan-2-ol;sulfurothioic O-acid?
butan-2-ol;sulfurothioic O-acid has a molecular weight of 188.27 g/mol, XLogP of 0.46, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;sulfurothioic O-acid is sourced from PubChem (CID 175241517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).