C22H16FNO5S — CID 18324892
4-[3-(4-fluorophenyl)-7-methoxy-4-oxochromen-2-yl]benzenesulfonamide (PubChem CID 18324892) has the molecular formula C22H16FNO5S and a molecular weight of 425.44 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-7-methoxy-4-oxochromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-fluorophenyl)-7-methoxy-4-oxochromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18324892 |
| Molecular Formula | C22H16FNO5S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-7-methoxy-4-oxochromen-2-yl]benzenesulfonamide |
| SMILES | COc1ccc2c(=O)c(-c3ccc(F)cc3)c(-c3ccc(S(N)(=O)=O)cc3)oc2c1 |
| InChI | InChI=1S/C22H16FNO5S/c1-28-16-8-11-18-19(12-16)29-22(14-4-9-17(10-5-14)30(24,26)27)20(21(18)25)13-2-6-15(23)7-3-13/h2-12H,1H3,(H2,24,26,27) |
| InChIKey | QIWVEUCOYYSJFY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |