C22H18O9S — CID 18325108
methyl 9-(1,3-benzodioxol-5-yl)-8-(methylsulfonyloxymethyl)benzo[g][1,3]benzodioxole-7-carboxylate (PubChem CID 18325108) has the molecular formula C22H18O9S and a molecular weight of 458.44 g/mol. Its IUPAC name is methyl 9-(1,3-benzodioxol-5-yl)-8-(methylsulfonyloxymethyl)benzo[g][1,3]benzodioxole-7-carboxylate.
| Compound Name | methyl 9-(1,3-benzodioxol-5-yl)-8-(methylsulfonyloxymethyl)benzo[g][1,3]benzodioxole-7-carboxylate |
|---|---|
| PubChem CID | 18325108 |
| Molecular Formula | C22H18O9S |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | methyl 9-(1,3-benzodioxol-5-yl)-8-(methylsulfonyloxymethyl)benzo[g][1,3]benzodioxole-7-carboxylate |
| SMILES | COC(=O)c1cc2ccc3c(c2c(-c2ccc4c(c2)OCO4)c1COS(C)(=O)=O)OCO3 |
| InChI | InChI=1S/C22H18O9S/c1-26-22(23)14-7-12-4-6-17-21(30-11-28-17)20(12)19(15(14)9-31-32(2,24)25)13-3-5-16-18(8-13)29-10-27-16/h3-8H,9-11H2,1-2H3 |
| InChIKey | CPYPMLFMAITBNF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|