C23H20O8 — CID 71584088
[8-(acetyloxymethyl)-9-(3,4-dihydroxyphenyl)benzo[g][1,3]benzodioxol-7-yl]methyl acetate (PubChem CID 71584088) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is [8-(acetyloxymethyl)-9-(3,4-dihydroxyphenyl)benzo[g][1,3]benzodioxol-7-yl]methyl acetate.
| Compound Name | [8-(acetyloxymethyl)-9-(3,4-dihydroxyphenyl)benzo[g][1,3]benzodioxol-7-yl]methyl acetate |
|---|---|
| PubChem CID | 71584088 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [8-(acetyloxymethyl)-9-(3,4-dihydroxyphenyl)benzo[g][1,3]benzodioxol-7-yl]methyl acetate |
| SMILES | CC(=O)OCc1cc2ccc3c(c2c(-c2ccc(O)c(O)c2)c1COC(C)=O)OCO3 |
| InChI | InChI=1S/C23H20O8/c1-12(24)28-9-16-7-14-4-6-20-23(31-11-30-20)22(14)21(17(16)10-29-13(2)25)15-3-5-18(26)19(27)8-15/h3-8,26-27H,9-11H2,1-2H3 |
| InChIKey | HZCCHJMXPHOPIW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|