C19H10FNO4 — CID 19353296
10-(4-fluorophenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione (PubChem CID 19353296) has the molecular formula C19H10FNO4 and a molecular weight of 335.29 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione.
| Compound Name | 10-(4-fluorophenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
|---|---|
| PubChem CID | 19353296 |
| Molecular Formula | C19H10FNO4 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 10-(4-fluorophenyl)-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
| SMILES | O=C1NC(=O)c2c1cc1ccc3c(c1c2-c1ccc(F)cc1)OCO3 |
| InChI | InChI=1S/C19H10FNO4/c20-11-4-1-9(2-5-11)14-15-10(3-6-13-17(15)25-8-24-13)7-12-16(14)19(23)21-18(12)22/h1-7H,8H2,(H,21,22,23) |
| InChIKey | ILCBZKIKEHEXQZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|