C19H16O6 — CID 71584087
4-[7,8-bis(hydroxymethyl)benzo[g][1,3]benzodioxol-9-yl]benzene-1,2-diol (PubChem CID 71584087) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 4-[7,8-bis(hydroxymethyl)benzo[g][1,3]benzodioxol-9-yl]benzene-1,2-diol.
| Compound Name | 4-[7,8-bis(hydroxymethyl)benzo[g][1,3]benzodioxol-9-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 71584087 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[7,8-bis(hydroxymethyl)benzo[g][1,3]benzodioxol-9-yl]benzene-1,2-diol |
| SMILES | OCc1cc2ccc3c(c2c(-c2ccc(O)c(O)c2)c1CO)OCO3 |
| InChI | InChI=1S/C19H16O6/c20-7-12-5-10-2-4-16-19(25-9-24-16)18(10)17(13(12)8-21)11-1-3-14(22)15(23)6-11/h1-6,20-23H,7-9H2 |
| InChIKey | IVGSVRSVEGRWGW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|