C19H10FNO5 — CID 101402576
10-(4-fluorophenyl)-8-hydroxy-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione (PubChem CID 101402576) has the molecular formula C19H10FNO5 and a molecular weight of 351.29 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-8-hydroxy-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione.
| Compound Name | 10-(4-fluorophenyl)-8-hydroxy-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
|---|---|
| PubChem CID | 101402576 |
| Molecular Formula | C19H10FNO5 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 10-(4-fluorophenyl)-8-hydroxy-[1,3]benzodioxolo[7,6-f]isoindole-7,9-dione |
| SMILES | O=C1c2cc3ccc4c(c3c(-c3ccc(F)cc3)c2C(=O)N1O)OCO4 |
| InChI | InChI=1S/C19H10FNO5/c20-11-4-1-9(2-5-11)14-15-10(3-6-13-17(15)26-8-25-13)7-12-16(14)19(23)21(24)18(12)22/h1-7,24H,8H2 |
| InChIKey | VOGDJMXOSJTTKS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|