C20H13NO5 — CID 139827026
5-(2-methoxyphenyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione (PubChem CID 139827026) has the molecular formula C20H13NO5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione.
| Compound Name | 5-(2-methoxyphenyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione |
|---|---|
| PubChem CID | 139827026 |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-(2-methoxyphenyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione |
| SMILES | COc1ccccc1-c1c2c(cc3cc4c(cc13)OCO4)C(=O)NC2=O |
| InChI | InChI=1S/C20H13NO5/c1-24-14-5-3-2-4-11(14)17-12-8-16-15(25-9-26-16)7-10(12)6-13-18(17)20(23)21-19(13)22/h2-8H,9H2,1H3,(H,21,22,23) |
| InChIKey | FFAXDHSXWRABBX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|