C14H14ClN3 — CID 18326542
2-chloro-N,N-bis(prop-2-enyl)quinazolin-4-amine (PubChem CID 18326542) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-chloro-N,N-bis(prop-2-enyl)quinazolin-4-amine.
| Compound Name | 2-chloro-N,N-bis(prop-2-enyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 18326542 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-chloro-N,N-bis(prop-2-enyl)quinazolin-4-amine |
| SMILES | C=CCN(CC=C)c1nc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C14H14ClN3/c1-3-9-18(10-4-2)13-11-7-5-6-8-12(11)16-14(15)17-13/h3-8H,1-2,9-10H2 |
| InChIKey | QUXAMAMFQMOWHA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|