C8H9FO4 — CID 18330854
6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 18330854) has the molecular formula C8H9FO4 and a molecular weight of 188.15 g/mol. Its IUPAC name is 6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | 6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 18330854 |
| Molecular Formula | C8H9FO4 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1CCC2C1C2(F)C(=O)O |
| InChI | InChI=1S/C8H9FO4/c9-8(7(12)13)4-2-1-3(5(4)8)6(10)11/h3-5H,1-2H2,(H,10,11)(H,12,13) |
| InChIKey | AIINQKNSEWEXAU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |