C24H24N6O — CID 18332676
[3-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidin-1-yl]-phenylmethanone (PubChem CID 18332676) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is [3-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidin-1-yl]-phenylmethanone.
| Compound Name | [3-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 18332676 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [3-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidin-1-yl]-phenylmethanone |
| SMILES | CN(c1nccc(-n2cnc3ccccc32)n1)C1CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C24H24N6O/c1-28(19-10-7-15-29(16-19)23(31)18-8-3-2-4-9-18)24-25-14-13-22(27-24)30-17-26-20-11-5-6-12-21(20)30/h2-6,8-9,11-14,17,19H,7,10,15-16H2,1H3 |
| InChIKey | RABKRHYPUUYKFS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |