C22H29N — CID 18333919
N-[(4-tert-butylphenyl)methyl]-N-ethyl-2-phenylprop-2-en-1-amine (PubChem CID 18333919) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-ethyl-2-phenylprop-2-en-1-amine.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-ethyl-2-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 18333919 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-ethyl-2-phenylprop-2-en-1-amine |
| SMILES | C=C(CN(CC)Cc1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N/c1-6-23(16-18(2)20-10-8-7-9-11-20)17-19-12-14-21(15-13-19)22(3,4)5/h7-15H,2,6,16-17H2,1,3-5H3 |
| InChIKey | NWCYITOCPWTYJB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |