C21H26ClN — CID 139921620
N-[(4-tert-butylphenyl)methyl]-2-(4-chlorophenyl)-N-methylprop-2-en-1-amine (PubChem CID 139921620) has the molecular formula C21H26ClN and a molecular weight of 327.90 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-(4-chlorophenyl)-N-methylprop-2-en-1-amine.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-(4-chlorophenyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 139921620 |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-(4-chlorophenyl)-N-methylprop-2-en-1-amine |
| SMILES | C=C(CN(C)Cc1ccc(C(C)(C)C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClN/c1-16(18-8-12-20(22)13-9-18)14-23(5)15-17-6-10-19(11-7-17)21(2,3)4/h6-13H,1,14-15H2,2-5H3 |
| InChIKey | JHJILOORJRBWEC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |