C24H27NS — CID 139821189
N-methyl-N-[[4-(2-phenylpropan-2-yl)phenyl]methyl]-2-thiophen-3-ylprop-2-en-1-amine (PubChem CID 139821189) has the molecular formula C24H27NS and a molecular weight of 361.55 g/mol. Its IUPAC name is N-methyl-N-[[4-(2-phenylpropan-2-yl)phenyl]methyl]-2-thiophen-3-ylprop-2-en-1-amine.
| Compound Name | N-methyl-N-[[4-(2-phenylpropan-2-yl)phenyl]methyl]-2-thiophen-3-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 139821189 |
| Molecular Formula | C24H27NS |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-methyl-N-[[4-(2-phenylpropan-2-yl)phenyl]methyl]-2-thiophen-3-ylprop-2-en-1-amine |
| SMILES | C=C(CN(C)Cc1ccc(C(C)(C)c2ccccc2)cc1)c1ccsc1 |
| InChI | InChI=1S/C24H27NS/c1-19(21-14-15-26-18-21)16-25(4)17-20-10-12-23(13-11-20)24(2,3)22-8-6-5-7-9-22/h5-15,18H,1,16-17H2,2-4H3 |
| InChIKey | VKWXAVXRPFUDIO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |