C22H22N6O — CID 18334725
4-[2-[[1-(cyclopropylmethyl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile (PubChem CID 18334725) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[2-[[1-(cyclopropylmethyl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-[[1-(cyclopropylmethyl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 18334725 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[2-[[1-(cyclopropylmethyl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(Cn2c(=O)n(CC3CC3)c3ccncc32)nc2ccccc21 |
| InChI | InChI=1S/C22H22N6O/c23-10-3-4-12-26-18-6-2-1-5-17(18)25-21(26)15-28-20-13-24-11-9-19(20)27(22(28)29)14-16-7-8-16/h1-2,5-6,9,11,13,16H,3-4,7-8,12,14-15H2 |
| InChIKey | RXRAJRFLQDSYQR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|