C24H18Cl2N8O2 — CID 18335003
N'-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 18335003) has the molecular formula C24H18Cl2N8O2 and a molecular weight of 521.37 g/mol. Its IUPAC name is N'-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18335003 |
| Molecular Formula | C24H18Cl2N8O2 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | N'-[5-(benzimidazol-1-yl)-4-(2,4-dichlorophenyl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNc2ncc(-n3cnc4ccccc43)c(-c3ccc(Cl)cc3Cl)n2)nc1 |
| InChI | InChI=1S/C24H18Cl2N8O2/c25-15-5-7-17(18(26)11-15)23-21(33-14-31-19-3-1-2-4-20(19)33)13-30-24(32-23)28-10-9-27-22-8-6-16(12-29-22)34(35)36/h1-8,11-14H,9-10H2,(H,27,29)(H,28,30,32) |
| InChIKey | UKNSWTHGRSUTFL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|