C38H41FN2O4 — CID 18335088
[4-[4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]-1-(naphthalene-1-carbonyl)pyrrolidin-3-yl]-4-hydroxybutyl] benzoate (PubChem CID 18335088) has the molecular formula C38H41FN2O4 and a molecular weight of 608.75 g/mol. Its IUPAC name is [4-[4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]-1-(naphthalene-1-carbonyl)pyrrolidin-3-yl]-4-hydroxybutyl] benzoate.
| Compound Name | [4-[4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]-1-(naphthalene-1-carbonyl)pyrrolidin-3-yl]-4-hydroxybutyl] benzoate |
|---|---|
| PubChem CID | 18335088 |
| Molecular Formula | C38H41FN2O4 |
| Molecular Weight | 608.75 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | [4-[4-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]-1-(naphthalene-1-carbonyl)pyrrolidin-3-yl]-4-hydroxybutyl] benzoate |
| SMILES | O=C(OCCCC(O)C1CN(C(=O)c2cccc3ccccc23)CC1CN1CCC(c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C38H41FN2O4/c39-32-17-15-27(16-18-32)28-19-21-40(22-20-28)24-31-25-41(37(43)34-13-6-11-29-8-4-5-12-33(29)34)26-35(31)36(42)14-7-23-45-38(44)30-9-2-1-3-10-30/h1-6,8-13,15-18,28,31,35-36,42H,7,14,19-26H2 |
| InChIKey | IMGXXYDOEUEVAX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.75 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|