C24H18ClF4NO — CID 18335727
5-(2-chlorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole (PubChem CID 18335727) has the molecular formula C24H18ClF4NO and a molecular weight of 447.86 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(2-chlorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 18335727 |
| Molecular Formula | C24H18ClF4NO |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 5-(2-chlorophenyl)-2-[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl]-3,4-dihydro-2H-pyrrole |
| SMILES | FC(F)C(F)(F)Oc1ccc(-c2ccc(C3CCC(c4ccccc4Cl)=N3)cc2)cc1 |
| InChI | InChI=1S/C24H18ClF4NO/c25-20-4-2-1-3-19(20)22-14-13-21(30-22)17-7-5-15(6-8-17)16-9-11-18(12-10-16)31-24(28,29)23(26)27/h1-12,21,23H,13-14H2 |
| InChIKey | OPRPNVPXTWXDGQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|