C26H21F5NO3+ — CID 18339143
(7-methylphenanthren-2-yl) 1-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]pyridin-1-ium-4-carboxylate (PubChem CID 18339143) has the molecular formula C26H21F5NO3+ and a molecular weight of 490.45 g/mol. Its IUPAC name is (7-methylphenanthren-2-yl) 1-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]pyridin-1-ium-4-carboxylate.
| Compound Name | (7-methylphenanthren-2-yl) 1-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]pyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 18339143 |
| Molecular Formula | C26H21F5NO3+ |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | (7-methylphenanthren-2-yl) 1-[2-(2,2,3,3,3-pentafluoropropoxy)ethyl]pyridin-1-ium-4-carboxylate |
| SMILES | Cc1ccc2c(ccc3cc(OC(=O)c4cc[n+](CCOCC(F)(F)C(F)(F)F)cc4)ccc32)c1 |
| InChI | InChI=1S/C26H21F5NO3/c1-17-2-6-22-19(14-17)3-4-20-15-21(5-7-23(20)22)35-24(33)18-8-10-32(11-9-18)12-13-34-16-25(27,28)26(29,30)31/h2-11,14-15H,12-13,16H2,1H3/q+1 |
| InChIKey | WCBCKFPUFLPYJN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|