C27H26N2O3 — CID 71549074
5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]-4-pyridin-3-ylchromen-2-one (PubChem CID 71549074) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]-4-pyridin-3-ylchromen-2-one.
| Compound Name | 5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]-4-pyridin-3-ylchromen-2-one |
|---|---|
| PubChem CID | 71549074 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]-4-pyridin-3-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(-c3cccnc3)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-18-14-24-27(23(15-25(30)32-24)22-4-3-9-28-16-22)19(2)26(18)21-7-5-20(6-8-21)17-29-10-12-31-13-11-29/h3-9,14-16H,10-13,17H2,1-2H3 |
| InChIKey | HDJFSGAJOLMWTO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|