C15H15N3 — CID 18341117
2-[isocyano-(2,4,6-trimethylphenyl)methyl]pyrazine (PubChem CID 18341117) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[isocyano-(2,4,6-trimethylphenyl)methyl]pyrazine.
| Compound Name | 2-[isocyano-(2,4,6-trimethylphenyl)methyl]pyrazine |
|---|---|
| PubChem CID | 18341117 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-[isocyano-(2,4,6-trimethylphenyl)methyl]pyrazine |
| SMILES | [C-]#[N+]C(c1cnccn1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H15N3/c1-10-7-11(2)14(12(3)8-10)15(16-4)13-9-17-5-6-18-13/h5-9,15H,1-3H3 |
| InChIKey | CNBGERZWAFOSDO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|