C15H26O9S2 — CID 18343713
[6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 18343713) has the molecular formula C15H26O9S2 and a molecular weight of 414.50 g/mol. Its IUPAC name is [6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 18343713 |
| Molecular Formula | C15H26O9S2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CCS(=O)(=O)CS(=O)(=O)CC1OC(C)C2OC(C)(C)OC2C1OC(C)=O |
| InChI | InChI=1S/C15H26O9S2/c1-6-25(17,18)8-26(19,20)7-11-13(22-10(3)16)14-12(9(2)21-11)23-15(4,5)24-14/h9,11-14H,6-8H2,1-5H3 |
| InChIKey | WPDXVYSVBLHURF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |