C13H24AcO8S2 — CID 23534159
actinium;6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 23534159) has the molecular formula C13H24AcO8S2 and a molecular weight of 599.46 g/mol. Its IUPAC name is actinium;6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | actinium;6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 23534159 |
| Molecular Formula | C13H24AcO8S2 |
| Molecular Weight | 599.46 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | actinium;6-(ethylsulfonylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CCS(=O)(=O)CS(=O)(=O)CC1OC(C)C2OC(C)(C)OC2C1O.[Ac] |
| InChI | InChI=1S/C13H24O8S2.Ac/c1-5-22(15,16)7-23(17,18)6-9-10(14)12-11(8(2)19-9)20-13(3,4)21-12;/h8-12,14H,5-7H2,1-4H3; |
| InChIKey | CUSSNMFRXJPPCI-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.46 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |