C13H24O5S — CID 10661331
(3aR,4S,6S,7S,7aS)-6-tert-butylsulfinyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 10661331) has the molecular formula C13H24O5S and a molecular weight of 292.40 g/mol. Its IUPAC name is (3aR,4S,6S,7S,7aS)-6-tert-butylsulfinyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,4S,6S,7S,7aS)-6-tert-butylsulfinyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 10661331 |
| Molecular Formula | C13H24O5S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3aR,4S,6S,7S,7aS)-6-tert-butylsulfinyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | C[C@@H]1O[C@@H](S(=O)C(C)(C)C)[C@@H](O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H24O5S/c1-7-9-10(18-13(5,6)17-9)8(14)11(16-7)19(15)12(2,3)4/h7-11,14H,1-6H3/t7-,8-,9+,10-,11-,19?/m0/s1 |
| InChIKey | CPDZJERVPUUWJR-VGBBTVEZSA-N |
| XLogP | 1.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |