C11H20O4S — CID 162419996
(3aR,6S,7R,7aR)-2,2-diethyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol (PubChem CID 162419996) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-2,2-diethyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol.
| Compound Name | (3aR,6S,7R,7aR)-2,2-diethyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol |
|---|---|
| PubChem CID | 162419996 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (3aR,6S,7R,7aR)-2,2-diethyl-6-methoxy-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]dioxol-7-ol |
| SMILES | CCC1(CC)O[C@@H]2[C@@H](O)[C@@H](OC)SC[C@@H]2O1 |
| InChI | InChI=1S/C11H20O4S/c1-4-11(5-2)14-7-6-16-10(13-3)8(12)9(7)15-11/h7-10,12H,4-6H2,1-3H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | KTENSODHKJKMCB-JXUBOQSCSA-N |
| XLogP | 1.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |