C12H24O3S2 — CID 134929672
(1S)-3-deuterio-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propan-1-ol (PubChem CID 134929672) has the molecular formula C12H24O3S2 and a molecular weight of 281.46 g/mol. Its IUPAC name is (1S)-3-deuterio-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propan-1-ol.
| Compound Name | (1S)-3-deuterio-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 134929672 |
| Molecular Formula | C12H24O3S2 |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1S)-3-deuterio-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propan-1-ol |
| SMILES | [2H]C(C[C@H](O)[C@H]1COC(C)(C)O1)(SCC)SCC |
| InChI | InChI=1S/C12H24O3S2/c1-5-16-11(17-6-2)7-9(13)10-8-14-12(3,4)15-10/h9-11,13H,5-8H2,1-4H3/t9-,10+/m0/s1/i11D |
| InChIKey | RFJOUDAKFXSLRC-WFJPGSTESA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|