C9H18O3S2 — CID 134882799
(2S,3S,4R)-2-[bis(ethylsulfanyl)methyl]oxolane-3,4-diol (PubChem CID 134882799) has the molecular formula C9H18O3S2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2S,3S,4R)-2-[bis(ethylsulfanyl)methyl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R)-2-[bis(ethylsulfanyl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 134882799 |
| Molecular Formula | C9H18O3S2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (2S,3S,4R)-2-[bis(ethylsulfanyl)methyl]oxolane-3,4-diol |
| SMILES | CCSC(SCC)[C@H]1OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H18O3S2/c1-3-13-9(14-4-2)8-7(11)6(10)5-12-8/h6-11H,3-5H2,1-2H3/t6-,7+,8+/m1/s1 |
| InChIKey | WNRMFFCEYVJXRI-CSMHCCOUSA-N |
| XLogP | 0.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|