C13H22O6S — CID 166449616
(3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-(2-methylprop-2-enylsulfonyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 166449616) has the molecular formula C13H22O6S and a molecular weight of 306.38 g/mol. Its IUPAC name is (3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-(2-methylprop-2-enylsulfonyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-(2-methylprop-2-enylsulfonyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 166449616 |
| Molecular Formula | C13H22O6S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-(2-methylprop-2-enylsulfonyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | C=C(C)CS(=O)(=O)[C@@H]1O[C@@H](C)[C@H](O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H22O6S/c1-7(2)6-20(15,16)12-11-10(9(14)8(3)17-12)18-13(4,5)19-11/h8-12,14H,1,6H2,2-5H3/t8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | XKWZCJXXDRAVRD-HGCLJGPKSA-N |
| XLogP | 0.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|