C10H18O6S — CID 166449652
(2S,3R,4R,5R,6S)-2-methyl-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol (PubChem CID 166449652) has the molecular formula C10H18O6S and a molecular weight of 266.31 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-methyl-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-methyl-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 166449652 |
| Molecular Formula | C10H18O6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-methyl-6-(2-methylprop-2-enylsulfonyl)oxane-3,4,5-triol |
| SMILES | C=C(C)CS(=O)(=O)[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O6S/c1-5(2)4-17(14,15)10-9(13)8(12)7(11)6(3)16-10/h6-13H,1,4H2,2-3H3/t6-,7-,8+,9+,10-/m0/s1 |
| InChIKey | UXQIDGAOVAREPG-OEZYJKACSA-N |
| XLogP | -1.20 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|