C12H24O7S — CID 46894459
(2R,3S,4S,5S,6R)-2-hexylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46894459) has the molecular formula C12H24O7S and a molecular weight of 312.38 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-hexylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-hexylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46894459 |
| Molecular Formula | C12H24O7S |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-hexylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCS(=O)(=O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H24O7S/c1-2-3-4-5-6-20(17,18)12-11(16)10(15)9(14)8(7-13)19-12/h8-16H,2-7H2,1H3/t8-,9-,10+,11+,12-/m1/s1 |
| InChIKey | SROORBDBUHCJSN-LDMBFOFVSA-N |
| XLogP | -1.22 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|