C7H14O7S — CID 70361694
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-methylsulfonyloxane-3,4,5-triol (PubChem CID 70361694) has the molecular formula C7H14O7S and a molecular weight of 242.25 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-methylsulfonyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-methylsulfonyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 70361694 |
| Molecular Formula | C7H14O7S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-methylsulfonyloxane-3,4,5-triol |
| SMILES | CS(=O)(=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O7S/c1-15(12,13)7-6(11)5(10)4(9)3(2-8)14-7/h3-11H,2H2,1H3/t3-,4-,5+,6+,7+/m1/s1 |
| InChIKey | USEGKTXSKVZOQI-VEIUFWFVSA-N |
| XLogP | -3.17 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |