C12H22O4S — CID 135036779
(3aR,6R)-6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 135036779) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is (3aR,6R)-6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,6R)-6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 135036779 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3aR,6R)-6-tert-butylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1(C)OC2C(O)[C@@H](SC(C)(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C12H22O4S/c1-11(2,3)17-10-8(13)9-7(6-14-10)15-12(4,5)16-9/h7-10,13H,6H2,1-5H3/t7-,8?,9?,10-/m1/s1 |
| InChIKey | OSJDVWUASPKXDL-SEZDTBSWSA-N |
| XLogP | 1.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |