C14H27O7PS2 — CID 18343718
6-(dimethylphosphorylmethylsulfanylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 18343718) has the molecular formula C14H27O7PS2 and a molecular weight of 402.47 g/mol. Its IUPAC name is 6-(dimethylphosphorylmethylsulfanylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | 6-(dimethylphosphorylmethylsulfanylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 18343718 |
| Molecular Formula | C14H27O7PS2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 6-(dimethylphosphorylmethylsulfanylmethylsulfonylmethyl)-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1OC(CS(=O)(=O)CSCP(C)(C)=O)C(O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C14H27O7PS2/c1-9-12-13(21-14(2,3)20-12)11(15)10(19-9)6-24(17,18)8-23-7-22(4,5)16/h9-13,15H,6-8H2,1-5H3 |
| InChIKey | VOMXKHDOYXSAAQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|