C15H23BFN12O2 — CID 18343895
CID 18343895 (PubChem CID 18343895) has the molecular formula C15H23BFN12O2 and a molecular weight of 433.24 g/mol.
| Compound Name | CID 18343895 |
|---|---|
| PubChem CID | 18343895 |
| Molecular Formula | C15H23BFN12O2 |
| Molecular Weight | 433.24 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | — |
| SMILES | CNc1nc(N[B]Nc2nc(NF)nc(N3CCOCC3)n2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H23BFN12O2/c1-18-10-19-11(22-14(21-10)28-2-6-30-7-3-28)25-16-26-12-20-13(27-17)24-15(23-12)29-4-8-31-9-5-29/h2-9H2,1H3,(H2,18,19,21,22,25)(H2,20,23,24,26,27) |
| InChIKey | SQBRBSYUXNXXOH-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 150.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.24 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|