C31H35F9O3 — CID 18344125
2-[2-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]-1,1-difluoroethyl]-5-(4-pentylcyclohexyl)-1,3-dioxane (PubChem CID 18344125) has the molecular formula C31H35F9O3 and a molecular weight of 626.60 g/mol. Its IUPAC name is 2-[2-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]-1,1-difluoroethyl]-5-(4-pentylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[2-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]-1,1-difluoroethyl]-5-(4-pentylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 18344125 |
| Molecular Formula | C31H35F9O3 |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 2-[2-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]-1,1-difluoroethyl]-5-(4-pentylcyclohexyl)-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2COC(C(F)(F)Cc3ccc(-c4cc(F)c(OC(F)(F)C(F)F)c(F)c4)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C31H35F9O3/c1-2-3-4-5-18-6-9-20(10-7-18)22-16-41-29(42-17-22)30(37,38)15-19-8-11-23(24(32)12-19)21-13-25(33)27(26(34)14-21)43-31(39,40)28(35)36/h8,11-14,18,20,22,28-29H,2-7,9-10,15-17H2,1H3 |
| InChIKey | UQFRICHYNASHSX-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.60 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|