C29H25F9O3 — CID 18344128
2-[2-[4-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]phenyl]-1,1-difluoroethyl]-5-propyl-1,3-dioxane (PubChem CID 18344128) has the molecular formula C29H25F9O3 and a molecular weight of 592.50 g/mol. Its IUPAC name is 2-[2-[4-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]phenyl]-1,1-difluoroethyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[2-[4-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]phenyl]-1,1-difluoroethyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 18344128 |
| Molecular Formula | C29H25F9O3 |
| Molecular Weight | 592.50 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 2-[2-[4-[4-[3,5-difluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-3-fluorophenyl]phenyl]-1,1-difluoroethyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(C(F)(F)Cc2ccc(-c3ccc(-c4cc(F)c(OC(F)(F)C(F)F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C29H25F9O3/c1-2-3-17-14-39-27(40-15-17)28(35,36)13-16-4-6-18(7-5-16)19-8-9-21(22(30)10-19)20-11-23(31)25(24(32)12-20)41-29(37,38)26(33)34/h4-12,17,26-27H,2-3,13-15H2,1H3 |
| InChIKey | QBAIJNAXQPYTBZ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.50 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|